C12H16N2O6S — CID 43468059
3,3-dimethyl-2-[(4-nitrophenyl)sulfonylamino]butanoic acid (PubChem CID 43468059) has the molecular formula C12H16N2O6S and a molecular weight of 316.34 g/mol. Its IUPAC name is 3,3-dimethyl-2-[(4-nitrophenyl)sulfonylamino]butanoic acid.
| Compound Name | 3,3-dimethyl-2-[(4-nitrophenyl)sulfonylamino]butanoic acid |
|---|---|
| PubChem CID | 43468059 |
| Molecular Formula | C12H16N2O6S |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 3,3-dimethyl-2-[(4-nitrophenyl)sulfonylamino]butanoic acid |
| SMILES | CC(C)(C)C(NS(=O)(=O)c1ccc([N+](=O)[O-])cc1)C(=O)O |
| InChI | InChI=1S/C12H16N2O6S/c1-12(2,3)10(11(15)16)13-21(19,20)9-6-4-8(5-7-9)14(17)18/h4-7,10,13H,1-3H3,(H,15,16) |
| InChIKey | VXGRFRGRKFEVQS-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 126.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|