C15H19N3O9S — CID 175750273
(2S)-2-[[(2S)-3-methyl-2-[(4-nitrophenyl)sulfonylamino]butanoyl]amino]butanedioic acid (PubChem CID 175750273) has the molecular formula C15H19N3O9S and a molecular weight of 417.40 g/mol. Its IUPAC name is (2S)-2-[[(2S)-3-methyl-2-[(4-nitrophenyl)sulfonylamino]butanoyl]amino]butanedioic acid.
| Compound Name | (2S)-2-[[(2S)-3-methyl-2-[(4-nitrophenyl)sulfonylamino]butanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 175750273 |
| Molecular Formula | C15H19N3O9S |
| Molecular Weight | 417.40 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | (2S)-2-[[(2S)-3-methyl-2-[(4-nitrophenyl)sulfonylamino]butanoyl]amino]butanedioic acid |
| SMILES | CC(C)[C@H](NS(=O)(=O)c1ccc([N+](=O)[O-])cc1)C(=O)N[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C15H19N3O9S/c1-8(2)13(14(21)16-11(15(22)23)7-12(19)20)17-28(26,27)10-5-3-9(4-6-10)18(24)25/h3-6,8,11,13,17H,7H2,1-2H3,(H,16,21)(H,19,20)(H,22,23)/t11-,13-/m0/s1 |
| InChIKey | ZQYVGKBGWBMFHW-AAEUAGOBSA-N |
| XLogP | -0.06 |
| TPSA | 193.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.40 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|