C29H39N5O9S — CID 178167964
tert-butyl (2S)-5-amino-2-[[(2S)-2-[[(2S)-3-methyl-2-[(4-nitrophenyl)sulfonylamino]butanoyl]amino]-3-phenylpropanoyl]amino]-5-oxopentanoate (PubChem CID 178167964) has the molecular formula C29H39N5O9S and a molecular weight of 633.72 g/mol. Its IUPAC name is tert-butyl (2S)-5-amino-2-[[(2S)-2-[[(2S)-3-methyl-2-[(4-nitrophenyl)sulfonylamino]butanoyl]amino]-3-phenylpropanoyl]amino]-5-oxopentanoate.
| Compound Name | tert-butyl (2S)-5-amino-2-[[(2S)-2-[[(2S)-3-methyl-2-[(4-nitrophenyl)sulfonylamino]butanoyl]amino]-3-phenylpropanoyl]amino]-5-oxopentanoate |
|---|---|
| PubChem CID | 178167964 |
| Molecular Formula | C29H39N5O9S |
| Molecular Weight | 633.72 g/mol |
| Exact Mass | 633.25 |
| IUPAC Name | tert-butyl (2S)-5-amino-2-[[(2S)-2-[[(2S)-3-methyl-2-[(4-nitrophenyl)sulfonylamino]butanoyl]amino]-3-phenylpropanoyl]amino]-5-oxopentanoate |
| SMILES | CC(C)[C@H](NS(=O)(=O)c1ccc([N+](=O)[O-])cc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCC(N)=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H39N5O9S/c1-18(2)25(33-44(41,42)21-13-11-20(12-14-21)34(39)40)27(37)32-23(17-19-9-7-6-8-10-19)26(36)31-22(15-16-24(30)35)28(38)43-29(3,4)5/h6-14,18,22-23,25,33H,15-17H2,1-5H3,(H2,30,35)(H,31,36)(H,32,37)/t22-,23-,25-/m0/s1 |
| InChIKey | VWMTVXOLOOHKKM-LSQMVHIFSA-N |
| XLogP | 1.72 |
| TPSA | 216.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.72 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|