C13H18N2O6S — CID 101137956
(3S)-4,4-dimethyl-3-[(4-nitrophenyl)sulfonylamino]pentanoic acid (PubChem CID 101137956) has the molecular formula C13H18N2O6S and a molecular weight of 330.36 g/mol. Its IUPAC name is (3S)-4,4-dimethyl-3-[(4-nitrophenyl)sulfonylamino]pentanoic acid.
| Compound Name | (3S)-4,4-dimethyl-3-[(4-nitrophenyl)sulfonylamino]pentanoic acid |
|---|---|
| PubChem CID | 101137956 |
| Molecular Formula | C13H18N2O6S |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | (3S)-4,4-dimethyl-3-[(4-nitrophenyl)sulfonylamino]pentanoic acid |
| SMILES | CC(C)(C)[C@H](CC(=O)O)NS(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H18N2O6S/c1-13(2,3)11(8-12(16)17)14-22(20,21)10-6-4-9(5-7-10)15(18)19/h4-7,11,14H,8H2,1-3H3,(H,16,17)/t11-/m0/s1 |
| InChIKey | DQLPDCBLXGUZSL-NSHDSACASA-N |
| XLogP | 1.76 |
| TPSA | 126.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|