C11H14N2O6S — CID 16731907
(3S)-3-[methyl-(4-nitrophenyl)sulfonylamino]butanoic acid (PubChem CID 16731907) has the molecular formula C11H14N2O6S and a molecular weight of 302.31 g/mol. Its IUPAC name is (3S)-3-[methyl-(4-nitrophenyl)sulfonylamino]butanoic acid.
| Compound Name | (3S)-3-[methyl-(4-nitrophenyl)sulfonylamino]butanoic acid |
|---|---|
| PubChem CID | 16731907 |
| Molecular Formula | C11H14N2O6S |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | (3S)-3-[methyl-(4-nitrophenyl)sulfonylamino]butanoic acid |
| SMILES | C[C@@H](CC(=O)O)N(C)S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H14N2O6S/c1-8(7-11(14)15)12(2)20(18,19)10-5-3-9(4-6-10)13(16)17/h3-6,8H,7H2,1-2H3,(H,14,15)/t8-/m0/s1 |
| InChIKey | DIZSBFLNKMBFOW-QMMMGPOBSA-N |
| XLogP | 1.08 |
| TPSA | 117.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|