C13H14N2O9S — CID 139086133
3-carboxy-4-hydroxybenzenesulfonate;(4-nitrophenyl)azanium;hydrate (PubChem CID 139086133) has the molecular formula C13H14N2O9S and a molecular weight of 374.33 g/mol. Its IUPAC name is 3-carboxy-4-hydroxybenzenesulfonate;(4-nitrophenyl)azanium;hydrate.
| Compound Name | 3-carboxy-4-hydroxybenzenesulfonate;(4-nitrophenyl)azanium;hydrate |
|---|---|
| PubChem CID | 139086133 |
| Molecular Formula | C13H14N2O9S |
| Molecular Weight | 374.33 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | 3-carboxy-4-hydroxybenzenesulfonate;(4-nitrophenyl)azanium;hydrate |
| SMILES | O.O=C(O)c1cc(S(=O)(=O)[O-])ccc1O.[NH3+]c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C7H6O6S.C6H6N2O2.H2O/c8-6-2-1-4(14(11,12)13)3-5(6)7(9)10;7-5-1-3-6(4-2-5)8(9)10;/h1-3,8H,(H,9,10)(H,11,12,13);1-4H,7H2;1H2 |
| InChIKey | RGUIRMFHTDSRMF-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 217.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.33 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|