C15H17NO6S — CID 171378099
3-carboxy-4-hydroxybenzenesulfonate;dimethyl(phenyl)azanium (PubChem CID 171378099) has the molecular formula C15H17NO6S and a molecular weight of 339.37 g/mol. Its IUPAC name is 3-carboxy-4-hydroxybenzenesulfonate;dimethyl(phenyl)azanium.
| Compound Name | 3-carboxy-4-hydroxybenzenesulfonate;dimethyl(phenyl)azanium |
|---|---|
| PubChem CID | 171378099 |
| Molecular Formula | C15H17NO6S |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | 3-carboxy-4-hydroxybenzenesulfonate;dimethyl(phenyl)azanium |
| SMILES | C[NH+](C)c1ccccc1.O=C(O)c1cc(S(=O)(=O)[O-])ccc1O |
| InChI | InChI=1S/C8H11N.C7H6O6S/c1-9(2)8-6-4-3-5-7-8;8-6-2-1-4(14(11,12)13)3-5(6)7(9)10/h3-7H,1-2H3;1-3,8H,(H,9,10)(H,11,12,13) |
| InChIKey | JWVRKHUEHWJWSN-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 119.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|