C9H11NO8S — CID 139086437
3-carboxy-4-hydroxybenzenesulfonate;carboxymethylazanium (PubChem CID 139086437) has the molecular formula C9H11NO8S and a molecular weight of 293.25 g/mol. Its IUPAC name is 3-carboxy-4-hydroxybenzenesulfonate;carboxymethylazanium.
| Compound Name | 3-carboxy-4-hydroxybenzenesulfonate;carboxymethylazanium |
|---|---|
| PubChem CID | 139086437 |
| Molecular Formula | C9H11NO8S |
| Molecular Weight | 293.25 g/mol |
| Exact Mass | 293.02 |
| IUPAC Name | 3-carboxy-4-hydroxybenzenesulfonate;carboxymethylazanium |
| SMILES | O=C(O)c1cc(S(=O)(=O)[O-])ccc1O.[NH3+]CC(=O)O |
| InChI | InChI=1S/C7H6O6S.C2H5NO2/c8-6-2-1-4(14(11,12)13)3-5(6)7(9)10;3-1-2(4)5/h1-3,8H,(H,9,10)(H,11,12,13);1,3H2,(H,4,5) |
| InChIKey | KIKMNCICOBXLAZ-UHFFFAOYSA-N |
| XLogP | -1.69 |
| TPSA | 179.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.25 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|