C15H22ClNO6S — CID 139041628
3-carboxy-4-hydroxybenzenesulfonate;1-(3-chloropropyl)piperidin-1-ium (PubChem CID 139041628) has the molecular formula C15H22ClNO6S and a molecular weight of 379.86 g/mol. Its IUPAC name is 3-carboxy-4-hydroxybenzenesulfonate;1-(3-chloropropyl)piperidin-1-ium.
| Compound Name | 3-carboxy-4-hydroxybenzenesulfonate;1-(3-chloropropyl)piperidin-1-ium |
|---|---|
| PubChem CID | 139041628 |
| Molecular Formula | C15H22ClNO6S |
| Molecular Weight | 379.86 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | 3-carboxy-4-hydroxybenzenesulfonate;1-(3-chloropropyl)piperidin-1-ium |
| SMILES | ClCCC[NH+]1CCCCC1.O=C(O)c1cc(S(=O)(=O)[O-])ccc1O |
| InChI | InChI=1S/C8H16ClN.C7H6O6S/c9-5-4-8-10-6-2-1-3-7-10;8-6-2-1-4(14(11,12)13)3-5(6)7(9)10/h1-8H2;1-3,8H,(H,9,10)(H,11,12,13) |
| InChIKey | XADQNTDAUYJYST-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 119.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.86 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|