C8H11N3O6S2 — CID 139071691
aminocarbamothioylazanium;3-carboxy-4-hydroxybenzenesulfonate (PubChem CID 139071691) has the molecular formula C8H11N3O6S2 and a molecular weight of 309.33 g/mol. Its IUPAC name is aminocarbamothioylazanium;3-carboxy-4-hydroxybenzenesulfonate.
| Compound Name | aminocarbamothioylazanium;3-carboxy-4-hydroxybenzenesulfonate |
|---|---|
| PubChem CID | 139071691 |
| Molecular Formula | C8H11N3O6S2 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.01 |
| IUPAC Name | aminocarbamothioylazanium;3-carboxy-4-hydroxybenzenesulfonate |
| SMILES | NNC([NH3+])=S.O=C(O)c1cc(S(=O)(=O)[O-])ccc1O |
| InChI | InChI=1S/C7H6O6S.CH5N3S/c8-6-2-1-4(14(11,12)13)3-5(6)7(9)10;2-1(5)4-3/h1-3,8H,(H,9,10)(H,11,12,13);3H2,(H3,2,4,5) |
| InChIKey | XCQCLUBVKXZZPA-UHFFFAOYSA-N |
| XLogP | -2.03 |
| TPSA | 180.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|