C13H15N3O9S — CID 139074901
3-carboxy-4-hydroxybenzenesulfonate;2-(2-methyl-4-nitro-1H-imidazol-3-ium-3-yl)ethanol (PubChem CID 139074901) has the molecular formula C13H15N3O9S and a molecular weight of 389.34 g/mol. Its IUPAC name is 3-carboxy-4-hydroxybenzenesulfonate;2-(2-methyl-4-nitro-1H-imidazol-3-ium-3-yl)ethanol.
| Compound Name | 3-carboxy-4-hydroxybenzenesulfonate;2-(2-methyl-4-nitro-1H-imidazol-3-ium-3-yl)ethanol |
|---|---|
| PubChem CID | 139074901 |
| Molecular Formula | C13H15N3O9S |
| Molecular Weight | 389.34 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | 3-carboxy-4-hydroxybenzenesulfonate;2-(2-methyl-4-nitro-1H-imidazol-3-ium-3-yl)ethanol |
| SMILES | Cc1[nH]cc([N+](=O)[O-])[n+]1CCO.O=C(O)c1cc(S(=O)(=O)[O-])ccc1O |
| InChI | InChI=1S/C7H6O6S.C6H9N3O3/c8-6-2-1-4(14(11,12)13)3-5(6)7(9)10;1-5-7-4-6(9(11)12)8(5)2-3-10/h1-3,8H,(H,9,10)(H,11,12,13);4,10H,2-3H2,1H3 |
| InChIKey | XOXFLNLKWNUCHP-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 197.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.34 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|