About 1-nitro-4-(trifluoromethyl)benzene;sulfuryl dichloride
1-nitro-4-(trifluoromethyl)benzene;sulfuryl dichloride (PubChem CID 174710355) has the molecular formula C7H4Cl2F3NO4S
and a molecular weight of 326.08 g/mol. Its IUPAC name is 1-nitro-4-(trifluoromethyl)benzene;sulfuryl dichloride.
Molecular Properties
| Compound Name | 1-nitro-4-(trifluoromethyl)benzene;sulfuryl dichloride |
| PubChem CID | 174710355 |
| Molecular Formula | C7H4Cl2F3NO4S |
| Molecular Weight | 326.08 g/mol |
| Exact Mass | 324.92 |
| IUPAC Name | 1-nitro-4-(trifluoromethyl)benzene;sulfuryl dichloride |
| SMILES | O=S(=O)(Cl)Cl.O=[N+]([O-])c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C7H4F3NO2.Cl2O2S/c8-7(9,10)5-1-3-6(4-2-5)11(12)13;1-5(2,3)4/h1-4H; |
| InChIKey | GYWJWPJHWYLKLS-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.08 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-nitro-4-(trifluoromethyl)benzene;sulfuryl dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-nitro-4-(trifluoromethyl)benzene;sulfuryl dichloride?
The IUPAC name of 1-nitro-4-(trifluoromethyl)benzene;sulfuryl dichloride (CID 174710355) is 1-nitro-4-(trifluoromethyl)benzene;sulfuryl dichloride.
What is the SMILES notation for 1-nitro-4-(trifluoromethyl)benzene;sulfuryl dichloride?
The canonical SMILES for 1-nitro-4-(trifluoromethyl)benzene;sulfuryl dichloride is O=S(=O)(Cl)Cl.O=[N+]([O-])c1ccc(C(F)(F)F)cc1.
What is the InChIKey of 1-nitro-4-(trifluoromethyl)benzene;sulfuryl dichloride?
The InChIKey is GYWJWPJHWYLKLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4F3NO2.Cl2O2S/c8-7(9,10)5-1-3-6(4-2-5)11(12)13;1-5(2,3)4/h1-4H;.
What are the key properties of 1-nitro-4-(trifluoromethyl)benzene;sulfuryl dichloride?
1-nitro-4-(trifluoromethyl)benzene;sulfuryl dichloride has a molecular weight of 326.08 g/mol, XLogP of 3.32, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-nitro-4-(trifluoromethyl)benzene;sulfuryl dichloride is sourced from PubChem (CID 174710355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).