C13H6Cl2F3NO6S — CID 118555564
(2,6-dichloro-4-nitrophenyl) [4-(trifluoromethyl)phenyl] sulfate (PubChem CID 118555564) has the molecular formula C13H6Cl2F3NO6S and a molecular weight of 432.16 g/mol. Its IUPAC name is (2,6-dichloro-4-nitrophenyl) [4-(trifluoromethyl)phenyl] sulfate.
| Compound Name | (2,6-dichloro-4-nitrophenyl) [4-(trifluoromethyl)phenyl] sulfate |
|---|---|
| PubChem CID | 118555564 |
| Molecular Formula | C13H6Cl2F3NO6S |
| Molecular Weight | 432.16 g/mol |
| Exact Mass | 430.92 |
| IUPAC Name | (2,6-dichloro-4-nitrophenyl) [4-(trifluoromethyl)phenyl] sulfate |
| SMILES | O=[N+]([O-])c1cc(Cl)c(OS(=O)(=O)Oc2ccc(C(F)(F)F)cc2)c(Cl)c1 |
| InChI | InChI=1S/C13H6Cl2F3NO6S/c14-10-5-8(19(20)21)6-11(15)12(10)25-26(22,23)24-9-3-1-7(2-4-9)13(16,17)18/h1-6H |
| InChIKey | SNDIFKZDMDMHPA-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.16 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|