About (3-fluoro-4-nitrophenyl) phenyl sulfate
(3-fluoro-4-nitrophenyl) phenyl sulfate (PubChem CID 11289945) has the molecular formula C12H8FNO6S
and a molecular weight of 313.26 g/mol. Its IUPAC name is (3-fluoro-4-nitrophenyl) phenyl sulfate.
Molecular Properties
| Compound Name | (3-fluoro-4-nitrophenyl) phenyl sulfate |
| PubChem CID | 11289945 |
| Molecular Formula | C12H8FNO6S |
| Molecular Weight | 313.26 g/mol |
| Exact Mass | 313.01 |
| IUPAC Name | (3-fluoro-4-nitrophenyl) phenyl sulfate |
| SMILES | O=[N+]([O-])c1ccc(OS(=O)(=O)Oc2ccccc2)cc1F |
| InChI | InChI=1S/C12H8FNO6S/c13-11-8-10(6-7-12(11)14(15)16)20-21(17,18)19-9-4-2-1-3-5-9/h1-8H |
| InChIKey | AIWUAPPMJALVSW-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.26 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3-fluoro-4-nitrophenyl) phenyl sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-fluoro-4-nitrophenyl) phenyl sulfate?
The IUPAC name of (3-fluoro-4-nitrophenyl) phenyl sulfate (CID 11289945) is (3-fluoro-4-nitrophenyl) phenyl sulfate.
What is the SMILES notation for (3-fluoro-4-nitrophenyl) phenyl sulfate?
The canonical SMILES for (3-fluoro-4-nitrophenyl) phenyl sulfate is O=[N+]([O-])c1ccc(OS(=O)(=O)Oc2ccccc2)cc1F.
What is the InChIKey of (3-fluoro-4-nitrophenyl) phenyl sulfate?
The InChIKey is AIWUAPPMJALVSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8FNO6S/c13-11-8-10(6-7-12(11)14(15)16)20-21(17,18)19-9-4-2-1-3-5-9/h1-8H.
What are the key properties of (3-fluoro-4-nitrophenyl) phenyl sulfate?
(3-fluoro-4-nitrophenyl) phenyl sulfate has a molecular weight of 313.26 g/mol, XLogP of 2.44, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-fluoro-4-nitrophenyl) phenyl sulfate is sourced from PubChem (CID 11289945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).