C11H13BrFNO3 — CID 64995464
4-(3-bromo-2,2-dimethylpropoxy)-2-fluoro-1-nitrobenzene (PubChem CID 64995464) has the molecular formula C11H13BrFNO3 and a molecular weight of 306.13 g/mol. Its IUPAC name is 4-(3-bromo-2,2-dimethylpropoxy)-2-fluoro-1-nitrobenzene.
| Compound Name | 4-(3-bromo-2,2-dimethylpropoxy)-2-fluoro-1-nitrobenzene |
|---|---|
| PubChem CID | 64995464 |
| Molecular Formula | C11H13BrFNO3 |
| Molecular Weight | 306.13 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | 4-(3-bromo-2,2-dimethylpropoxy)-2-fluoro-1-nitrobenzene |
| SMILES | CC(C)(CBr)COc1ccc([N+](=O)[O-])c(F)c1 |
| InChI | InChI=1S/C11H13BrFNO3/c1-11(2,6-12)7-17-8-3-4-10(14(15)16)9(13)5-8/h3-5H,6-7H2,1-2H3 |
| InChIKey | AUSDRDUMPIPAHE-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.13 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|