C13H15FN2O5 — CID 63920916
methyl 2-amino-2-cyclopropyl-3-(3-fluoro-4-nitrophenoxy)propanoate (PubChem CID 63920916) has the molecular formula C13H15FN2O5 and a molecular weight of 298.27 g/mol. Its IUPAC name is methyl 2-amino-2-cyclopropyl-3-(3-fluoro-4-nitrophenoxy)propanoate.
| Compound Name | methyl 2-amino-2-cyclopropyl-3-(3-fluoro-4-nitrophenoxy)propanoate |
|---|---|
| PubChem CID | 63920916 |
| Molecular Formula | C13H15FN2O5 |
| Molecular Weight | 298.27 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | methyl 2-amino-2-cyclopropyl-3-(3-fluoro-4-nitrophenoxy)propanoate |
| SMILES | COC(=O)C(N)(COc1ccc([N+](=O)[O-])c(F)c1)C1CC1 |
| InChI | InChI=1S/C13H15FN2O5/c1-20-12(17)13(15,8-2-3-8)7-21-9-4-5-11(16(18)19)10(14)6-9/h4-6,8H,2-3,7,15H2,1H3 |
| InChIKey | GGNXVPAIEZUWLV-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 104.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.27 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|