C14H10F3NO3 — CID 116790912
4-(2,2-difluoro-2-phenylethoxy)-2-fluoro-1-nitrobenzene (PubChem CID 116790912) has the molecular formula C14H10F3NO3 and a molecular weight of 297.23 g/mol. Its IUPAC name is 4-(2,2-difluoro-2-phenylethoxy)-2-fluoro-1-nitrobenzene.
| Compound Name | 4-(2,2-difluoro-2-phenylethoxy)-2-fluoro-1-nitrobenzene |
|---|---|
| PubChem CID | 116790912 |
| Molecular Formula | C14H10F3NO3 |
| Molecular Weight | 297.23 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 4-(2,2-difluoro-2-phenylethoxy)-2-fluoro-1-nitrobenzene |
| SMILES | O=[N+]([O-])c1ccc(OCC(F)(F)c2ccccc2)cc1F |
| InChI | InChI=1S/C14H10F3NO3/c15-12-8-11(6-7-13(12)18(19)20)21-9-14(16,17)10-4-2-1-3-5-10/h1-8H,9H2 |
| InChIKey | YQVWGOQAFNFQPC-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.23 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|