C10H10F3NO5S — CID 88575146
[1,1,1-trifluoro-2-(4-nitrophenyl)propan-2-yl] methanesulfonate (PubChem CID 88575146) has the molecular formula C10H10F3NO5S and a molecular weight of 313.25 g/mol. Its IUPAC name is [1,1,1-trifluoro-2-(4-nitrophenyl)propan-2-yl] methanesulfonate.
| Compound Name | [1,1,1-trifluoro-2-(4-nitrophenyl)propan-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 88575146 |
| Molecular Formula | C10H10F3NO5S |
| Molecular Weight | 313.25 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | [1,1,1-trifluoro-2-(4-nitrophenyl)propan-2-yl] methanesulfonate |
| SMILES | CC(OS(C)(=O)=O)(c1ccc([N+](=O)[O-])cc1)C(F)(F)F |
| InChI | InChI=1S/C10H10F3NO5S/c1-9(10(11,12)13,19-20(2,17)18)7-3-5-8(6-4-7)14(15)16/h3-6H,1-2H3 |
| InChIKey | OPIHHRAZDOYFII-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.25 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|