C18H12F9NO5S — CID 59229507
[1-[3,5-bis(trifluoromethyl)phenyl]-2,2,2-trifluoro-1-(3-methyl-4-nitrophenyl)ethyl] methanesulfonate (PubChem CID 59229507) has the molecular formula C18H12F9NO5S and a molecular weight of 525.35 g/mol. Its IUPAC name is [1-[3,5-bis(trifluoromethyl)phenyl]-2,2,2-trifluoro-1-(3-methyl-4-nitrophenyl)ethyl] methanesulfonate.
| Compound Name | [1-[3,5-bis(trifluoromethyl)phenyl]-2,2,2-trifluoro-1-(3-methyl-4-nitrophenyl)ethyl] methanesulfonate |
|---|---|
| PubChem CID | 59229507 |
| Molecular Formula | C18H12F9NO5S |
| Molecular Weight | 525.35 g/mol |
| Exact Mass | 525.03 |
| IUPAC Name | [1-[3,5-bis(trifluoromethyl)phenyl]-2,2,2-trifluoro-1-(3-methyl-4-nitrophenyl)ethyl] methanesulfonate |
| SMILES | Cc1cc(C(OS(C)(=O)=O)(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)C(F)(F)F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H12F9NO5S/c1-9-5-10(3-4-14(9)28(29)30)15(18(25,26)27,33-34(2,31)32)11-6-12(16(19,20)21)8-13(7-11)17(22,23)24/h3-8H,1-2H3 |
| InChIKey | XRFKSDQBUONVPD-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.35 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|