C20H20F3NO3 — CID 167468194
4-[(1R,3R)-2,2-dimethyl-3-[4-(trifluoromethyl)phenyl]cyclobutyl]oxy-2-methyl-1-nitrobenzene (PubChem CID 167468194) has the molecular formula C20H20F3NO3 and a molecular weight of 379.38 g/mol. Its IUPAC name is 4-[(1R,3R)-2,2-dimethyl-3-[4-(trifluoromethyl)phenyl]cyclobutyl]oxy-2-methyl-1-nitrobenzene.
| Compound Name | 4-[(1R,3R)-2,2-dimethyl-3-[4-(trifluoromethyl)phenyl]cyclobutyl]oxy-2-methyl-1-nitrobenzene |
|---|---|
| PubChem CID | 167468194 |
| Molecular Formula | C20H20F3NO3 |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 4-[(1R,3R)-2,2-dimethyl-3-[4-(trifluoromethyl)phenyl]cyclobutyl]oxy-2-methyl-1-nitrobenzene |
| SMILES | Cc1cc(O[C@@H]2C[C@H](c3ccc(C(F)(F)F)cc3)C2(C)C)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H20F3NO3/c1-12-10-15(8-9-17(12)24(25)26)27-18-11-16(19(18,2)3)13-4-6-14(7-5-13)20(21,22)23/h4-10,16,18H,11H2,1-3H3/t16-,18-/m1/s1 |
| InChIKey | YDOPHLZUGPNHBI-SJLPKXTDSA-N |
| XLogP | 5.88 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|