C22H12F6N4O10 — CID 141170569
1,5-bis[2,6-dinitro-4-(trifluoromethyl)phenoxy]-2,4-dimethylbenzene (PubChem CID 141170569) has the molecular formula C22H12F6N4O10 and a molecular weight of 606.34 g/mol. Its IUPAC name is 1,5-bis[2,6-dinitro-4-(trifluoromethyl)phenoxy]-2,4-dimethylbenzene.
| Compound Name | 1,5-bis[2,6-dinitro-4-(trifluoromethyl)phenoxy]-2,4-dimethylbenzene |
|---|---|
| PubChem CID | 141170569 |
| Molecular Formula | C22H12F6N4O10 |
| Molecular Weight | 606.34 g/mol |
| Exact Mass | 606.05 |
| IUPAC Name | 1,5-bis[2,6-dinitro-4-(trifluoromethyl)phenoxy]-2,4-dimethylbenzene |
| SMILES | Cc1cc(C)c(Oc2c([N+](=O)[O-])cc(C(F)(F)F)cc2[N+](=O)[O-])cc1Oc1c([N+](=O)[O-])cc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H12F6N4O10/c1-9-3-10(2)18(42-20-15(31(37)38)6-12(22(26,27)28)7-16(20)32(39)40)8-17(9)41-19-13(29(33)34)4-11(21(23,24)25)5-14(19)30(35)36/h3-8H,1-2H3 |
| InChIKey | LACDNRQLWXJLSR-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 191.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.34 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|