C13H15F3N2O5 — CID 89493073
2-[(3S)-hexan-3-yl]oxy-1,3-dinitro-5-(trifluoromethyl)benzene (PubChem CID 89493073) has the molecular formula C13H15F3N2O5 and a molecular weight of 336.27 g/mol. Its IUPAC name is 2-[(3S)-hexan-3-yl]oxy-1,3-dinitro-5-(trifluoromethyl)benzene.
| Compound Name | 2-[(3S)-hexan-3-yl]oxy-1,3-dinitro-5-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 89493073 |
| Molecular Formula | C13H15F3N2O5 |
| Molecular Weight | 336.27 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 2-[(3S)-hexan-3-yl]oxy-1,3-dinitro-5-(trifluoromethyl)benzene |
| SMILES | CCC[C@H](CC)Oc1c([N+](=O)[O-])cc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H15F3N2O5/c1-3-5-9(4-2)23-12-10(17(19)20)6-8(13(14,15)16)7-11(12)18(21)22/h6-7,9H,3-5H2,1-2H3/t9-/m0/s1 |
| InChIKey | LLJFNMAJSXWBIP-VIFPVBQESA-N |
| XLogP | 4.48 |
| TPSA | 95.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.27 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|