C15H18F3N3O6 — CID 150876950
N-[1-(1,3-dioxolan-2-yl)butyl]-N-methyl-2,6-dinitro-4-(trifluoromethyl)aniline (PubChem CID 150876950) has the molecular formula C15H18F3N3O6 and a molecular weight of 393.32 g/mol. Its IUPAC name is N-[1-(1,3-dioxolan-2-yl)butyl]-N-methyl-2,6-dinitro-4-(trifluoromethyl)aniline.
| Compound Name | N-[1-(1,3-dioxolan-2-yl)butyl]-N-methyl-2,6-dinitro-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 150876950 |
| Molecular Formula | C15H18F3N3O6 |
| Molecular Weight | 393.32 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | N-[1-(1,3-dioxolan-2-yl)butyl]-N-methyl-2,6-dinitro-4-(trifluoromethyl)aniline |
| SMILES | CCCC(C1OCCO1)N(C)c1c([N+](=O)[O-])cc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H18F3N3O6/c1-3-4-10(14-26-5-6-27-14)19(2)13-11(20(22)23)7-9(15(16,17)18)8-12(13)21(24)25/h7-8,10,14H,3-6H2,1-2H3 |
| InChIKey | KVERHHKKXAFOCE-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.32 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|