C13H15F3N4O4 — CID 7313016
(3S,5S)-1-[2,6-dinitro-4-(trifluoromethyl)phenyl]-3,5-dimethylpiperazine (PubChem CID 7313016) has the molecular formula C13H15F3N4O4 and a molecular weight of 348.28 g/mol. Its IUPAC name is (3S,5S)-1-[2,6-dinitro-4-(trifluoromethyl)phenyl]-3,5-dimethylpiperazine.
| Compound Name | (3S,5S)-1-[2,6-dinitro-4-(trifluoromethyl)phenyl]-3,5-dimethylpiperazine |
|---|---|
| PubChem CID | 7313016 |
| Molecular Formula | C13H15F3N4O4 |
| Molecular Weight | 348.28 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | (3S,5S)-1-[2,6-dinitro-4-(trifluoromethyl)phenyl]-3,5-dimethylpiperazine |
| SMILES | C[C@H]1CN(c2c([N+](=O)[O-])cc(C(F)(F)F)cc2[N+](=O)[O-])C[C@H](C)N1 |
| InChI | InChI=1S/C13H15F3N4O4/c1-7-5-18(6-8(2)17-7)12-10(19(21)22)3-9(13(14,15)16)4-11(12)20(23)24/h3-4,7-8,17H,5-6H2,1-2H3/t7-,8-/m0/s1 |
| InChIKey | QQXPEFSDYYTWGB-YUMQZZPRSA-N |
| XLogP | 2.71 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.28 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|