C12H13F3N4O4 — CID 2765776
1-[2,6-dinitro-4-(trifluoromethyl)phenyl]-1,4-diazepane (PubChem CID 2765776) has the molecular formula C12H13F3N4O4 and a molecular weight of 334.25 g/mol. Its IUPAC name is 1-[2,6-dinitro-4-(trifluoromethyl)phenyl]-1,4-diazepane.
| Compound Name | 1-[2,6-dinitro-4-(trifluoromethyl)phenyl]-1,4-diazepane |
|---|---|
| PubChem CID | 2765776 |
| Molecular Formula | C12H13F3N4O4 |
| Molecular Weight | 334.25 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 1-[2,6-dinitro-4-(trifluoromethyl)phenyl]-1,4-diazepane |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)cc([N+](=O)[O-])c1N1CCCNCC1 |
| InChI | InChI=1S/C12H13F3N4O4/c13-12(14,15)8-6-9(18(20)21)11(10(7-8)19(22)23)17-4-1-2-16-3-5-17/h6-7,16H,1-5H2 |
| InChIKey | LIMYOJCJMVMSQY-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.25 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|