C12H17N3O2 — CID 13007953
1-(3-methyl-4-nitrophenyl)-1,4-diazepane (PubChem CID 13007953) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is 1-(3-methyl-4-nitrophenyl)-1,4-diazepane.
| Compound Name | 1-(3-methyl-4-nitrophenyl)-1,4-diazepane |
|---|---|
| PubChem CID | 13007953 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | 1-(3-methyl-4-nitrophenyl)-1,4-diazepane |
| SMILES | Cc1cc(N2CCCNCC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H17N3O2/c1-10-9-11(3-4-12(10)15(16)17)14-7-2-5-13-6-8-14/h3-4,9,13H,2,5-8H2,1H3 |
| InChIKey | ZXWIRAVMKNGJDH-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|