C19H24N4O2 — CID 58707294
5-(1,4-diazepan-1-yl)-2-nitro-N-(1-phenylethyl)aniline (PubChem CID 58707294) has the molecular formula C19H24N4O2 and a molecular weight of 340.43 g/mol. Its IUPAC name is 5-(1,4-diazepan-1-yl)-2-nitro-N-(1-phenylethyl)aniline.
| Compound Name | 5-(1,4-diazepan-1-yl)-2-nitro-N-(1-phenylethyl)aniline |
|---|---|
| PubChem CID | 58707294 |
| Molecular Formula | C19H24N4O2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | 5-(1,4-diazepan-1-yl)-2-nitro-N-(1-phenylethyl)aniline |
| SMILES | CC(Nc1cc(N2CCCNCC2)ccc1[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C19H24N4O2/c1-15(16-6-3-2-4-7-16)21-18-14-17(8-9-19(18)23(24)25)22-12-5-10-20-11-13-22/h2-4,6-9,14-15,20-21H,5,10-13H2,1H3 |
| InChIKey | YYOUCRVVRHCTCQ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 70.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|