C18H20BrN3O2 — CID 2870859
N-[1-(4-bromophenyl)ethyl]-2-nitro-5-pyrrolidin-1-ylaniline (PubChem CID 2870859) has the molecular formula C18H20BrN3O2 and a molecular weight of 390.28 g/mol. Its IUPAC name is N-[1-(4-bromophenyl)ethyl]-2-nitro-5-pyrrolidin-1-ylaniline.
| Compound Name | N-[1-(4-bromophenyl)ethyl]-2-nitro-5-pyrrolidin-1-ylaniline |
|---|---|
| PubChem CID | 2870859 |
| Molecular Formula | C18H20BrN3O2 |
| Molecular Weight | 390.28 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | N-[1-(4-bromophenyl)ethyl]-2-nitro-5-pyrrolidin-1-ylaniline |
| SMILES | CC(Nc1cc(N2CCCC2)ccc1[N+](=O)[O-])c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H20BrN3O2/c1-13(14-4-6-15(19)7-5-14)20-17-12-16(21-10-2-3-11-21)8-9-18(17)22(23)24/h4-9,12-13,20H,2-3,10-11H2,1H3 |
| InChIKey | GZLYXCMFOOAGMW-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.28 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|