C25H28N4O4S2 — CID 40733521
5-[4-(4-methylsulfanylphenyl)sulfonylpiperazin-1-yl]-2-nitro-N-[(1R)-1-phenylethyl]aniline (PubChem CID 40733521) has the molecular formula C25H28N4O4S2 and a molecular weight of 512.66 g/mol. Its IUPAC name is 5-[4-(4-methylsulfanylphenyl)sulfonylpiperazin-1-yl]-2-nitro-N-[(1R)-1-phenylethyl]aniline.
| Compound Name | 5-[4-(4-methylsulfanylphenyl)sulfonylpiperazin-1-yl]-2-nitro-N-[(1R)-1-phenylethyl]aniline |
|---|---|
| PubChem CID | 40733521 |
| Molecular Formula | C25H28N4O4S2 |
| Molecular Weight | 512.66 g/mol |
| Exact Mass | 512.16 |
| IUPAC Name | 5-[4-(4-methylsulfanylphenyl)sulfonylpiperazin-1-yl]-2-nitro-N-[(1R)-1-phenylethyl]aniline |
| SMILES | CSc1ccc(S(=O)(=O)N2CCN(c3ccc([N+](=O)[O-])c(N[C@H](C)c4ccccc4)c3)CC2)cc1 |
| InChI | InChI=1S/C25H28N4O4S2/c1-19(20-6-4-3-5-7-20)26-24-18-21(8-13-25(24)29(30)31)27-14-16-28(17-15-27)35(32,33)23-11-9-22(34-2)10-12-23/h3-13,18-19,26H,14-17H2,1-2H3/t19-/m1/s1 |
| InChIKey | VPRPNNZAJGXFGS-LJQANCHMSA-N |
| XLogP | 5.00 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.66 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|