C26H27N5O4S2 — CID 98312673
5-[4-[(2-methyl-1,3-benzothiazol-5-yl)sulfonyl]piperazin-1-yl]-2-nitro-N-[(1S)-1-phenylethyl]aniline (PubChem CID 98312673) has the molecular formula C26H27N5O4S2 and a molecular weight of 537.67 g/mol. Its IUPAC name is 5-[4-[(2-methyl-1,3-benzothiazol-5-yl)sulfonyl]piperazin-1-yl]-2-nitro-N-[(1S)-1-phenylethyl]aniline.
| Compound Name | 5-[4-[(2-methyl-1,3-benzothiazol-5-yl)sulfonyl]piperazin-1-yl]-2-nitro-N-[(1S)-1-phenylethyl]aniline |
|---|---|
| PubChem CID | 98312673 |
| Molecular Formula | C26H27N5O4S2 |
| Molecular Weight | 537.67 g/mol |
| Exact Mass | 537.15 |
| IUPAC Name | 5-[4-[(2-methyl-1,3-benzothiazol-5-yl)sulfonyl]piperazin-1-yl]-2-nitro-N-[(1S)-1-phenylethyl]aniline |
| SMILES | Cc1nc2cc(S(=O)(=O)N3CCN(c4ccc([N+](=O)[O-])c(N[C@@H](C)c5ccccc5)c4)CC3)ccc2s1 |
| InChI | InChI=1S/C26H27N5O4S2/c1-18(20-6-4-3-5-7-20)27-23-16-21(8-10-25(23)31(32)33)29-12-14-30(15-13-29)37(34,35)22-9-11-26-24(17-22)28-19(2)36-26/h3-11,16-18,27H,12-15H2,1-2H3/t18-/m0/s1 |
| InChIKey | YDLVCCOAJUWQPM-SFHVURJKSA-N |
| XLogP | 5.20 |
| TPSA | 108.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.67 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|