C19H23ClN4O4S — CID 2980468
5-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-2-nitro-N-propan-2-ylaniline (PubChem CID 2980468) has the molecular formula C19H23ClN4O4S and a molecular weight of 438.94 g/mol. Its IUPAC name is 5-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-2-nitro-N-propan-2-ylaniline.
| Compound Name | 5-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-2-nitro-N-propan-2-ylaniline |
|---|---|
| PubChem CID | 2980468 |
| Molecular Formula | C19H23ClN4O4S |
| Molecular Weight | 438.94 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | 5-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-2-nitro-N-propan-2-ylaniline |
| SMILES | CC(C)Nc1cc(N2CCN(S(=O)(=O)c3ccc(Cl)cc3)CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H23ClN4O4S/c1-14(2)21-18-13-16(5-8-19(18)24(25)26)22-9-11-23(12-10-22)29(27,28)17-6-3-15(20)4-7-17/h3-8,13-14,21H,9-12H2,1-2H3 |
| InChIKey | WIIVWRBKRIPFLW-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.94 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|