C22H28N4O4S — CID 2968085
N-ethyl-2-nitro-5-[4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)piperazin-1-yl]aniline (PubChem CID 2968085) has the molecular formula C22H28N4O4S and a molecular weight of 444.56 g/mol. Its IUPAC name is N-ethyl-2-nitro-5-[4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)piperazin-1-yl]aniline.
| Compound Name | N-ethyl-2-nitro-5-[4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)piperazin-1-yl]aniline |
|---|---|
| PubChem CID | 2968085 |
| Molecular Formula | C22H28N4O4S |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | N-ethyl-2-nitro-5-[4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)piperazin-1-yl]aniline |
| SMILES | CCNc1cc(N2CCN(S(=O)(=O)c3ccc4c(c3)CCCC4)CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H28N4O4S/c1-2-23-21-16-19(8-10-22(21)26(27)28)24-11-13-25(14-12-24)31(29,30)20-9-7-17-5-3-4-6-18(17)15-20/h7-10,15-16,23H,2-6,11-14H2,1H3 |
| InChIKey | JIAWUUBQVZRHIG-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|