C20H24N4O4S — CID 2936502
5-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]-2-nitro-N-prop-2-enylaniline (PubChem CID 2936502) has the molecular formula C20H24N4O4S and a molecular weight of 416.50 g/mol. Its IUPAC name is 5-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]-2-nitro-N-prop-2-enylaniline.
| Compound Name | 5-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]-2-nitro-N-prop-2-enylaniline |
|---|---|
| PubChem CID | 2936502 |
| Molecular Formula | C20H24N4O4S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 5-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]-2-nitro-N-prop-2-enylaniline |
| SMILES | C=CCNc1cc(N2CCN(S(=O)(=O)c3ccc(C)cc3)CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H24N4O4S/c1-3-10-21-19-15-17(6-9-20(19)24(25)26)22-11-13-23(14-12-22)29(27,28)18-7-4-16(2)5-8-18/h3-9,15,21H,1,10-14H2,2H3 |
| InChIKey | VXOUMAIGJXWXGB-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|