C13H18N2O2 — CID 115760457
4-(1,4-diazepan-1-yl)-2-methylbenzoic acid (PubChem CID 115760457) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 4-(1,4-diazepan-1-yl)-2-methylbenzoic acid.
| Compound Name | 4-(1,4-diazepan-1-yl)-2-methylbenzoic acid |
|---|---|
| PubChem CID | 115760457 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 4-(1,4-diazepan-1-yl)-2-methylbenzoic acid |
| SMILES | Cc1cc(N2CCCNCC2)ccc1C(=O)O |
| InChI | InChI=1S/C13H18N2O2/c1-10-9-11(3-4-12(10)13(16)17)15-7-2-5-14-6-8-15/h3-4,9,14H,2,5-8H2,1H3,(H,16,17) |
| InChIKey | GDWUGFQASMIZHO-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |