C13H13F3N4O5 — CID 5161589
1-[4-[2,6-dinitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]ethanone (PubChem CID 5161589) has the molecular formula C13H13F3N4O5 and a molecular weight of 362.26 g/mol. Its IUPAC name is 1-[4-[2,6-dinitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[2,6-dinitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 5161589 |
| Molecular Formula | C13H13F3N4O5 |
| Molecular Weight | 362.26 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | 1-[4-[2,6-dinitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(c2c([N+](=O)[O-])cc(C(F)(F)F)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C13H13F3N4O5/c1-8(21)17-2-4-18(5-3-17)12-10(19(22)23)6-9(13(14,15)16)7-11(12)20(24)25/h6-7H,2-5H2,1H3 |
| InChIKey | HZXNLLRBDYYHQS-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 109.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.26 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|