C16H20F3N3O4 — CID 7176886
(5S)-1-[2,6-dinitro-4-(trifluoromethyl)phenyl]-3,3,5-trimethylazepane (PubChem CID 7176886) has the molecular formula C16H20F3N3O4 and a molecular weight of 375.35 g/mol. Its IUPAC name is (5S)-1-[2,6-dinitro-4-(trifluoromethyl)phenyl]-3,3,5-trimethylazepane.
| Compound Name | (5S)-1-[2,6-dinitro-4-(trifluoromethyl)phenyl]-3,3,5-trimethylazepane |
|---|---|
| PubChem CID | 7176886 |
| Molecular Formula | C16H20F3N3O4 |
| Molecular Weight | 375.35 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | (5S)-1-[2,6-dinitro-4-(trifluoromethyl)phenyl]-3,3,5-trimethylazepane |
| SMILES | C[C@@H]1CCN(c2c([N+](=O)[O-])cc(C(F)(F)F)cc2[N+](=O)[O-])CC(C)(C)C1 |
| InChI | InChI=1S/C16H20F3N3O4/c1-10-4-5-20(9-15(2,3)8-10)14-12(21(23)24)6-11(16(17,18)19)7-13(14)22(25)26/h6-7,10H,4-5,8-9H2,1-3H3/t10-/m1/s1 |
| InChIKey | DNLYKRBIDIHFQR-SNVBAGLBSA-N |
| XLogP | 4.78 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.35 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|