C16H20F3N3O2 — CID 3689889
2-nitro-4-(trifluoromethyl)-N-[(3,3,5-trimethylcyclohexylidene)amino]aniline (PubChem CID 3689889) has the molecular formula C16H20F3N3O2 and a molecular weight of 343.35 g/mol. Its IUPAC name is 2-nitro-4-(trifluoromethyl)-N-[(3,3,5-trimethylcyclohexylidene)amino]aniline.
| Compound Name | 2-nitro-4-(trifluoromethyl)-N-[(3,3,5-trimethylcyclohexylidene)amino]aniline |
|---|---|
| PubChem CID | 3689889 |
| Molecular Formula | C16H20F3N3O2 |
| Molecular Weight | 343.35 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 2-nitro-4-(trifluoromethyl)-N-[(3,3,5-trimethylcyclohexylidene)amino]aniline |
| SMILES | CC1CC(=NNc2ccc(C(F)(F)F)cc2[N+](=O)[O-])CC(C)(C)C1 |
| InChI | InChI=1S/C16H20F3N3O2/c1-10-6-12(9-15(2,3)8-10)20-21-13-5-4-11(16(17,18)19)7-14(13)22(23)24/h4-5,7,10,21H,6,8-9H2,1-3H3 |
| InChIKey | LRQLZZCNRGVQPM-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 67.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.35 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|