C19H28N4O4 — CID 51717850
N-[(E)-[(3R,5R)-3-methyl-5-(2-methylpentan-2-yl)cyclohexylidene]amino]-2,4-dinitroaniline (PubChem CID 51717850) has the molecular formula C19H28N4O4 and a molecular weight of 376.46 g/mol. Its IUPAC name is N-[(E)-[(3R,5R)-3-methyl-5-(2-methylpentan-2-yl)cyclohexylidene]amino]-2,4-dinitroaniline.
| Compound Name | N-[(E)-[(3R,5R)-3-methyl-5-(2-methylpentan-2-yl)cyclohexylidene]amino]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 51717850 |
| Molecular Formula | C19H28N4O4 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | N-[(E)-[(3R,5R)-3-methyl-5-(2-methylpentan-2-yl)cyclohexylidene]amino]-2,4-dinitroaniline |
| SMILES | CCCC(C)(C)[C@H]1C/C(=N/Nc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])C[C@H](C)C1 |
| InChI | InChI=1S/C19H28N4O4/c1-5-8-19(3,4)14-9-13(2)10-15(11-14)20-21-17-7-6-16(22(24)25)12-18(17)23(26)27/h6-7,12-14,21H,5,8-11H2,1-4H3/b20-15+/t13-,14-/m1/s1 |
| InChIKey | DIYFSYBOKDUFNM-PQLLLQIDSA-N |
| XLogP | 5.53 |
| TPSA | 110.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|