C18H22N4O6 — CID 5378283
2-[(5Z)-5-[(2,4-dinitrophenyl)hydrazinylidene]-4-methylcyclohex-3-en-1-yl]propan-2-yl acetate (PubChem CID 5378283) has the molecular formula C18H22N4O6 and a molecular weight of 390.40 g/mol. Its IUPAC name is 2-[(5Z)-5-[(2,4-dinitrophenyl)hydrazinylidene]-4-methylcyclohex-3-en-1-yl]propan-2-yl acetate.
| Compound Name | 2-[(5Z)-5-[(2,4-dinitrophenyl)hydrazinylidene]-4-methylcyclohex-3-en-1-yl]propan-2-yl acetate |
|---|---|
| PubChem CID | 5378283 |
| Molecular Formula | C18H22N4O6 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 2-[(5Z)-5-[(2,4-dinitrophenyl)hydrazinylidene]-4-methylcyclohex-3-en-1-yl]propan-2-yl acetate |
| SMILES | CC(=O)OC(C)(C)C1CC=C(C)/C(=N\Nc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C18H22N4O6/c1-11-5-6-13(18(3,4)28-12(2)23)9-16(11)20-19-15-8-7-14(21(24)25)10-17(15)22(26)27/h5,7-8,10,13,19H,6,9H2,1-4H3/b20-16- |
| InChIKey | QGGWWWXVPMEXLA-SILNSSARSA-N |
| XLogP | 3.97 |
| TPSA | 136.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|