C14H16F3N3O2 — CID 4540398
N-[(4-methylcyclohexylidene)amino]-2-nitro-4-(trifluoromethyl)aniline (PubChem CID 4540398) has the molecular formula C14H16F3N3O2 and a molecular weight of 315.29 g/mol. Its IUPAC name is N-[(4-methylcyclohexylidene)amino]-2-nitro-4-(trifluoromethyl)aniline.
| Compound Name | N-[(4-methylcyclohexylidene)amino]-2-nitro-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 4540398 |
| Molecular Formula | C14H16F3N3O2 |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | N-[(4-methylcyclohexylidene)amino]-2-nitro-4-(trifluoromethyl)aniline |
| SMILES | CC1CCC(=NNc2ccc(C(F)(F)F)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C14H16F3N3O2/c1-9-2-5-11(6-3-9)18-19-12-7-4-10(14(15,16)17)8-13(12)20(21)22/h4,7-9,19H,2-3,5-6H2,1H3/b18-11- |
| InChIKey | MDUDUWWFYUZZAY-WQRHYEAKSA-N |
| XLogP | 4.59 |
| TPSA | 67.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|