C14H16ClF3N2 — CID 4136280
2-chloro-N-[(4-methylcyclohexylidene)amino]-5-(trifluoromethyl)aniline (PubChem CID 4136280) has the molecular formula C14H16ClF3N2 and a molecular weight of 304.74 g/mol. Its IUPAC name is 2-chloro-N-[(4-methylcyclohexylidene)amino]-5-(trifluoromethyl)aniline.
| Compound Name | 2-chloro-N-[(4-methylcyclohexylidene)amino]-5-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 4136280 |
| Molecular Formula | C14H16ClF3N2 |
| Molecular Weight | 304.74 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 2-chloro-N-[(4-methylcyclohexylidene)amino]-5-(trifluoromethyl)aniline |
| SMILES | CC1CCC(=NNc2cc(C(F)(F)F)ccc2Cl)CC1 |
| InChI | InChI=1S/C14H16ClF3N2/c1-9-2-5-11(6-3-9)19-20-13-8-10(14(16,17)18)4-7-12(13)15/h4,7-9,20H,2-3,5-6H2,1H3/b19-11- |
| InChIKey | RMGUBBSBVBIFMG-ODLFYWEKSA-N |
| XLogP | 5.34 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.74 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|