C18H21ClF3N3O2 — CID 6989422
N-[2-chloro-5-(trifluoromethyl)phenyl]-N'-[[(2R)-2-methylcyclohexylidene]amino]butanediamide (PubChem CID 6989422) has the molecular formula C18H21ClF3N3O2 and a molecular weight of 403.83 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)phenyl]-N'-[[(2R)-2-methylcyclohexylidene]amino]butanediamide.
| Compound Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-N'-[[(2R)-2-methylcyclohexylidene]amino]butanediamide |
|---|---|
| PubChem CID | 6989422 |
| Molecular Formula | C18H21ClF3N3O2 |
| Molecular Weight | 403.83 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-N'-[[(2R)-2-methylcyclohexylidene]amino]butanediamide |
| SMILES | C[C@@H]1CCCCC1=NNC(=O)CCC(=O)Nc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C18H21ClF3N3O2/c1-11-4-2-3-5-14(11)24-25-17(27)9-8-16(26)23-15-10-12(18(20,21)22)6-7-13(15)19/h6-7,10-11H,2-5,8-9H2,1H3,(H,23,26)(H,25,27)/t11-/m1/s1 |
| InChIKey | BHGYXGLLKPBAAY-LLVKDONJSA-N |
| XLogP | 4.76 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.83 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|