C22H24ClF3N2O3S — CID 1296344
N-[2-chloro-5-(trifluoromethyl)phenyl]-3-[4-(cyclohexylsulfamoyl)phenyl]propanamide (PubChem CID 1296344) has the molecular formula C22H24ClF3N2O3S and a molecular weight of 488.96 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)phenyl]-3-[4-(cyclohexylsulfamoyl)phenyl]propanamide.
| Compound Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-3-[4-(cyclohexylsulfamoyl)phenyl]propanamide |
|---|---|
| PubChem CID | 1296344 |
| Molecular Formula | C22H24ClF3N2O3S |
| Molecular Weight | 488.96 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-3-[4-(cyclohexylsulfamoyl)phenyl]propanamide |
| SMILES | O=C(CCc1ccc(S(=O)(=O)NC2CCCCC2)cc1)Nc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C22H24ClF3N2O3S/c23-19-12-9-16(22(24,25)26)14-20(19)27-21(29)13-8-15-6-10-18(11-7-15)32(30,31)28-17-4-2-1-3-5-17/h6-7,9-12,14,17,28H,1-5,8,13H2,(H,27,29) |
| InChIKey | CCSZSDIAOCPKKO-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.96 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |