C18H13Cl3F3N3O2 — CID 6277415
N-[2-chloro-5-(trifluoromethyl)phenyl]-N'-[(Z)-(2,4-dichlorophenyl)methylideneamino]butanediamide (PubChem CID 6277415) has the molecular formula C18H13Cl3F3N3O2 and a molecular weight of 466.67 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)phenyl]-N'-[(Z)-(2,4-dichlorophenyl)methylideneamino]butanediamide.
| Compound Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-N'-[(Z)-(2,4-dichlorophenyl)methylideneamino]butanediamide |
|---|---|
| PubChem CID | 6277415 |
| Molecular Formula | C18H13Cl3F3N3O2 |
| Molecular Weight | 466.67 g/mol |
| Exact Mass | 465.00 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-N'-[(Z)-(2,4-dichlorophenyl)methylideneamino]butanediamide |
| SMILES | O=C(CCC(=O)Nc1cc(C(F)(F)F)ccc1Cl)N/N=C\c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H13Cl3F3N3O2/c19-12-3-1-10(14(21)8-12)9-25-27-17(29)6-5-16(28)26-15-7-11(18(22,23)24)2-4-13(15)20/h1-4,7-9H,5-6H2,(H,26,28)(H,27,29)/b25-9- |
| InChIKey | PCGHYYUCFSSOED-MWYAZZEHSA-N |
| XLogP | 5.53 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.67 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|