C14H18Cl2N3O2+ — CID 4744533
N-[(2,4-dichlorophenyl)methylideneamino]-3-morpholin-4-ium-4-ylpropanamide (PubChem CID 4744533) has the molecular formula C14H18Cl2N3O2+ and a molecular weight of 331.22 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methylideneamino]-3-morpholin-4-ium-4-ylpropanamide.
| Compound Name | N-[(2,4-dichlorophenyl)methylideneamino]-3-morpholin-4-ium-4-ylpropanamide |
|---|---|
| PubChem CID | 4744533 |
| Molecular Formula | C14H18Cl2N3O2+ |
| Molecular Weight | 331.22 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methylideneamino]-3-morpholin-4-ium-4-ylpropanamide |
| SMILES | O=C(CC[NH+]1CCOCC1)NN=Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H17Cl2N3O2/c15-12-2-1-11(13(16)9-12)10-17-18-14(20)3-4-19-5-7-21-8-6-19/h1-2,9-10H,3-8H2,(H,18,20)/p+1 |
| InChIKey | GVFUQJKAAMCOJJ-UHFFFAOYSA-O |
| XLogP | 0.75 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.22 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|