C14H19Cl2N4OS+ — CID 7934130
1-[(Z)-(2,4-dichlorophenyl)methylideneamino]-3-(2-morpholin-4-ium-4-ylethyl)thiourea (PubChem CID 7934130) has the molecular formula C14H19Cl2N4OS+ and a molecular weight of 362.31 g/mol. Its IUPAC name is 1-[(Z)-(2,4-dichlorophenyl)methylideneamino]-3-(2-morpholin-4-ium-4-ylethyl)thiourea.
| Compound Name | 1-[(Z)-(2,4-dichlorophenyl)methylideneamino]-3-(2-morpholin-4-ium-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 7934130 |
| Molecular Formula | C14H19Cl2N4OS+ |
| Molecular Weight | 362.31 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 1-[(Z)-(2,4-dichlorophenyl)methylideneamino]-3-(2-morpholin-4-ium-4-ylethyl)thiourea |
| SMILES | S=C(NCC[NH+]1CCOCC1)N/N=C\c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H18Cl2N4OS/c15-12-2-1-11(13(16)9-12)10-18-19-14(22)17-3-4-20-5-7-21-8-6-20/h1-2,9-10H,3-8H2,(H2,17,19,22)/p+1/b18-10- |
| InChIKey | UUUCUEBEPNPBSP-ZDLGFXPLSA-O |
| XLogP | 0.71 |
| TPSA | 50.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.31 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|