C14H21N4O3S+ — CID 135852452
1-[(E)-(3,4-dihydroxyphenyl)methylideneamino]-3-(2-morpholin-4-ium-4-ylethyl)thiourea (PubChem CID 135852452) has the molecular formula C14H21N4O3S+ and a molecular weight of 325.41 g/mol. Its IUPAC name is 1-[(E)-(3,4-dihydroxyphenyl)methylideneamino]-3-(2-morpholin-4-ium-4-ylethyl)thiourea.
| Compound Name | 1-[(E)-(3,4-dihydroxyphenyl)methylideneamino]-3-(2-morpholin-4-ium-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 135852452 |
| Molecular Formula | C14H21N4O3S+ |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 1-[(E)-(3,4-dihydroxyphenyl)methylideneamino]-3-(2-morpholin-4-ium-4-ylethyl)thiourea |
| SMILES | Oc1ccc(/C=N/NC(=S)NCC[NH+]2CCOCC2)cc1O |
| InChI | InChI=1S/C14H20N4O3S/c19-12-2-1-11(9-13(12)20)10-16-17-14(22)15-3-4-18-5-7-21-8-6-18/h1-2,9-10,19-20H,3-8H2,(H2,15,17,22)/p+1/b16-10+ |
| InChIKey | SQXVEGIYCLPMSR-MHWRWJLKSA-O |
| XLogP | -1.19 |
| TPSA | 90.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|