C21H27N4O2S+ — CID 9411414
1-(3-morpholin-4-ium-4-ylpropyl)-3-[(Z)-(3-phenoxyphenyl)methylideneamino]thiourea (PubChem CID 9411414) has the molecular formula C21H27N4O2S+ and a molecular weight of 399.54 g/mol. Its IUPAC name is 1-(3-morpholin-4-ium-4-ylpropyl)-3-[(Z)-(3-phenoxyphenyl)methylideneamino]thiourea.
| Compound Name | 1-(3-morpholin-4-ium-4-ylpropyl)-3-[(Z)-(3-phenoxyphenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 9411414 |
| Molecular Formula | C21H27N4O2S+ |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | 1-(3-morpholin-4-ium-4-ylpropyl)-3-[(Z)-(3-phenoxyphenyl)methylideneamino]thiourea |
| SMILES | S=C(NCCC[NH+]1CCOCC1)N/N=C\c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C21H26N4O2S/c28-21(22-10-5-11-25-12-14-26-15-13-25)24-23-17-18-6-4-9-20(16-18)27-19-7-2-1-3-8-19/h1-4,6-9,16-17H,5,10-15H2,(H2,22,24,28)/p+1/b23-17- |
| InChIKey | JFPCZAULUHOLKV-QJOMJCCJSA-O |
| XLogP | 1.58 |
| TPSA | 59.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|