C20H24N4O2S — CID 7934173
1-(2-morpholin-4-ylethyl)-3-[(Z)-(3-phenoxyphenyl)methylideneamino]thiourea (PubChem CID 7934173) has the molecular formula C20H24N4O2S and a molecular weight of 384.50 g/mol. Its IUPAC name is 1-(2-morpholin-4-ylethyl)-3-[(Z)-(3-phenoxyphenyl)methylideneamino]thiourea.
| Compound Name | 1-(2-morpholin-4-ylethyl)-3-[(Z)-(3-phenoxyphenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 7934173 |
| Molecular Formula | C20H24N4O2S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 1-(2-morpholin-4-ylethyl)-3-[(Z)-(3-phenoxyphenyl)methylideneamino]thiourea |
| SMILES | S=C(NCCN1CCOCC1)N/N=C\c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C20H24N4O2S/c27-20(21-9-10-24-11-13-25-14-12-24)23-22-16-17-5-4-8-19(15-17)26-18-6-2-1-3-7-18/h1-8,15-16H,9-14H2,(H2,21,23,27)/b22-16- |
| InChIKey | BAWQNSHTPVLKRQ-JWGURIENSA-N |
| XLogP | 2.61 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|