C23H29N4OS+ — CID 9411301
1-[(E)-[(E)-1,3-diphenylprop-2-enylidene]amino]-3-(3-morpholin-4-ium-4-ylpropyl)thiourea (PubChem CID 9411301) has the molecular formula C23H29N4OS+ and a molecular weight of 409.58 g/mol. Its IUPAC name is 1-[(E)-[(E)-1,3-diphenylprop-2-enylidene]amino]-3-(3-morpholin-4-ium-4-ylpropyl)thiourea.
| Compound Name | 1-[(E)-[(E)-1,3-diphenylprop-2-enylidene]amino]-3-(3-morpholin-4-ium-4-ylpropyl)thiourea |
|---|---|
| PubChem CID | 9411301 |
| Molecular Formula | C23H29N4OS+ |
| Molecular Weight | 409.58 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | 1-[(E)-[(E)-1,3-diphenylprop-2-enylidene]amino]-3-(3-morpholin-4-ium-4-ylpropyl)thiourea |
| SMILES | S=C(NCCC[NH+]1CCOCC1)N/N=C(\C=C\c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H28N4OS/c29-23(24-14-7-15-27-16-18-28-19-17-27)26-25-22(21-10-5-2-6-11-21)13-12-20-8-3-1-4-9-20/h1-6,8-13H,7,14-19H2,(H2,24,26,29)/p+1/b13-12+,25-22+ |
| InChIKey | LKPXTSJWAGNDQA-OZGAKYLSSA-O |
| XLogP | 1.87 |
| TPSA | 50.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.58 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|